C27H20O9 — CID 59935786
2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid (PubChem CID 59935786) has the molecular formula C27H20O9 and a molecular weight of 488.45 g/mol. Its IUPAC name is 2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid.
| Compound Name | 2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59935786 |
| Molecular Formula | C27H20O9 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1C(=O)Oc1ccc(-c2ccc(Oc3ccc(O)cc3COO)cc2)cc1 |
| InChI | InChI=1S/C27H20O9/c28-19-6-12-25(18(13-19)15-34-33)35-21-7-1-16(2-8-21)17-3-9-22(10-4-17)36-27(32)23-11-5-20(29)14-24(23)26(30)31/h1-14,28-29,33H,15H2,(H,30,31) |
| InChIKey | NYDHOUDFKNZGEK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|