C28H22O10 — CID 159684271
formaldehyde;2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid (PubChem CID 159684271) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is formaldehyde;2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid.
| Compound Name | formaldehyde;2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 159684271 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | formaldehyde;2-[4-[4-[2-(hydroperoxymethyl)-4-hydroxyphenoxy]phenyl]phenoxy]carbonyl-5-hydroxybenzoic acid |
| SMILES | C=O.O=C(O)c1cc(O)ccc1C(=O)Oc1ccc(-c2ccc(Oc3ccc(O)cc3COO)cc2)cc1 |
| InChI | InChI=1S/C27H20O9.CH2O/c28-19-6-12-25(18(13-19)15-34-33)35-21-7-1-16(2-8-21)17-3-9-22(10-4-17)36-27(32)23-11-5-20(29)14-24(23)26(30)31;1-2/h1-14,28-29,33H,15H2,(H,30,31);1H2 |
| InChIKey | MVOXEEMONVWCCI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|