C48H36O9 — CID 20721751
[3,5-bis[(2-methoxy-5-phenylbenzoyl)oxy]phenyl] 2-methoxy-5-phenylbenzoate (PubChem CID 20721751) has the molecular formula C48H36O9 and a molecular weight of 756.81 g/mol. Its IUPAC name is [3,5-bis[(2-methoxy-5-phenylbenzoyl)oxy]phenyl] 2-methoxy-5-phenylbenzoate.
| Compound Name | [3,5-bis[(2-methoxy-5-phenylbenzoyl)oxy]phenyl] 2-methoxy-5-phenylbenzoate |
|---|---|
| PubChem CID | 20721751 |
| Molecular Formula | C48H36O9 |
| Molecular Weight | 756.81 g/mol |
| Exact Mass | 756.24 |
| IUPAC Name | [3,5-bis[(2-methoxy-5-phenylbenzoyl)oxy]phenyl] 2-methoxy-5-phenylbenzoate |
| SMILES | COc1ccc(-c2ccccc2)cc1C(=O)Oc1cc(OC(=O)c2cc(-c3ccccc3)ccc2OC)cc(OC(=O)c2cc(-c3ccccc3)ccc2OC)c1 |
| InChI | InChI=1S/C48H36O9/c1-52-43-22-19-34(31-13-7-4-8-14-31)25-40(43)46(49)55-37-28-38(56-47(50)41-26-35(20-23-44(41)53-2)32-15-9-5-10-16-32)30-39(29-37)57-48(51)42-27-36(21-24-45(42)54-3)33-17-11-6-12-18-33/h4-30H,1-3H3 |
| InChIKey | PASJJWKXPWXKFH-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.81 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|