C30H26O8S — CID 59936196
2-[4-[4-[[2-(hydroperoxymethyl)-5-methylphenyl]methylperoxy]phenyl]sulfanylphenoxy]carbonyl-4-methylbenzoic acid (PubChem CID 59936196) has the molecular formula C30H26O8S and a molecular weight of 546.60 g/mol. Its IUPAC name is 2-[4-[4-[[2-(hydroperoxymethyl)-5-methylphenyl]methylperoxy]phenyl]sulfanylphenoxy]carbonyl-4-methylbenzoic acid.
| Compound Name | 2-[4-[4-[[2-(hydroperoxymethyl)-5-methylphenyl]methylperoxy]phenyl]sulfanylphenoxy]carbonyl-4-methylbenzoic acid |
|---|---|
| PubChem CID | 59936196 |
| Molecular Formula | C30H26O8S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 2-[4-[4-[[2-(hydroperoxymethyl)-5-methylphenyl]methylperoxy]phenyl]sulfanylphenoxy]carbonyl-4-methylbenzoic acid |
| SMILES | Cc1ccc(COO)c(COOc2ccc(Sc3ccc(OC(=O)c4cc(C)ccc4C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H26O8S/c1-19-3-5-21(17-35-34)22(15-19)18-36-38-24-8-12-26(13-9-24)39-25-10-6-23(7-11-25)37-30(33)28-16-20(2)4-14-27(28)29(31)32/h3-16,34H,17-18H2,1-2H3,(H,31,32) |
| InChIKey | UTFJCVSHIIYZIA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|