C31H30N2O6 — CID 59935918
2-[[4-[[4-[[2-(hydroperoxymethyl)-4-methylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid (PubChem CID 59935918) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-[[4-[[4-[[2-(hydroperoxymethyl)-4-methylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid.
| Compound Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-4-methylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 59935918 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-4-methylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-5-methylbenzoic acid |
| SMILES | Cc1ccc(CONc2ccc(Cc3ccc(NC(=O)c4ccc(C)cc4C(=O)O)cc3)cc2)c(COO)c1 |
| InChI | InChI=1S/C31H30N2O6/c1-20-3-9-24(25(15-20)19-39-37)18-38-33-27-12-7-23(8-13-27)17-22-5-10-26(11-6-22)32-30(34)28-14-4-21(2)16-29(28)31(35)36/h3-16,33,37H,17-19H2,1-2H3,(H,32,34)(H,35,36) |
| InChIKey | MQXNEIRGVWZBFW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|