C35H36N2O8 — CID 20733185
2-[[4-[3-[4-[(2-carboxy-5-methylbenzoyl)amino]phenoxy]-2,2-dimethylpropoxy]anilino]oxymethyl]-4-methylbenzoic acid (PubChem CID 20733185) has the molecular formula C35H36N2O8 and a molecular weight of 612.68 g/mol. Its IUPAC name is 2-[[4-[3-[4-[(2-carboxy-5-methylbenzoyl)amino]phenoxy]-2,2-dimethylpropoxy]anilino]oxymethyl]-4-methylbenzoic acid.
| Compound Name | 2-[[4-[3-[4-[(2-carboxy-5-methylbenzoyl)amino]phenoxy]-2,2-dimethylpropoxy]anilino]oxymethyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 20733185 |
| Molecular Formula | C35H36N2O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 2-[[4-[3-[4-[(2-carboxy-5-methylbenzoyl)amino]phenoxy]-2,2-dimethylpropoxy]anilino]oxymethyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(CONc2ccc(OCC(C)(C)COc3ccc(NC(=O)c4cc(C)ccc4C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C35H36N2O8/c1-22-5-15-29(33(39)40)24(17-22)19-45-37-26-9-13-28(14-10-26)44-21-35(3,4)20-43-27-11-7-25(8-12-27)36-32(38)31-18-23(2)6-16-30(31)34(41)42/h5-18,37H,19-21H2,1-4H3,(H,36,38)(H,39,40)(H,41,42) |
| InChIKey | UCWKUTUGGSCLDS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|