C28H22N2O8 — CID 20733372
2-[[4-[4-[(2-carboxyphenyl)methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid (PubChem CID 20733372) has the molecular formula C28H22N2O8 and a molecular weight of 514.49 g/mol. Its IUPAC name is 2-[[4-[4-[(2-carboxyphenyl)methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid.
| Compound Name | 2-[[4-[4-[(2-carboxyphenyl)methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 20733372 |
| Molecular Formula | C28H22N2O8 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[[4-[4-[(2-carboxyphenyl)methoxyamino]phenoxy]phenyl]carbamoyl]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccccc1CONc1ccc(Oc2ccc(NC(=O)c3ccc(O)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H22N2O8/c31-20-9-14-24(25(15-20)28(35)36)26(32)29-18-5-10-21(11-6-18)38-22-12-7-19(8-13-22)30-37-16-17-3-1-2-4-23(17)27(33)34/h1-15,30-31H,16H2,(H,29,32)(H,33,34)(H,35,36) |
| InChIKey | FDGRGADIFNHVFH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|