C40H30N2O7 — CID 20733347
2-[[4-[4-[(2-carboxy-5-phenylbenzoyl)amino]phenoxy]anilino]oxymethyl]-4-phenylbenzoic acid (PubChem CID 20733347) has the molecular formula C40H30N2O7 and a molecular weight of 650.69 g/mol. Its IUPAC name is 2-[[4-[4-[(2-carboxy-5-phenylbenzoyl)amino]phenoxy]anilino]oxymethyl]-4-phenylbenzoic acid.
| Compound Name | 2-[[4-[4-[(2-carboxy-5-phenylbenzoyl)amino]phenoxy]anilino]oxymethyl]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 20733347 |
| Molecular Formula | C40H30N2O7 |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 2-[[4-[4-[(2-carboxy-5-phenylbenzoyl)amino]phenoxy]anilino]oxymethyl]-4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1CONc1ccc(Oc2ccc(NC(=O)c3cc(-c4ccccc4)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C40H30N2O7/c43-38(37-24-29(12-22-36(37)40(46)47)27-9-5-2-6-10-27)41-31-13-17-33(18-14-31)49-34-19-15-32(16-20-34)42-48-25-30-23-28(11-21-35(30)39(44)45)26-7-3-1-4-8-26/h1-24,42H,25H2,(H,41,43)(H,44,45)(H,46,47) |
| InChIKey | XGOIWMGGCDEOPS-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|