C43H36N2O10 — CID 20733227
2-[[4-[4-[2-[4-[4-[(2-carboxy-5-hydroxybenzoyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]anilino]oxymethyl]-4-hydroxybenzoic acid (PubChem CID 20733227) has the molecular formula C43H36N2O10 and a molecular weight of 740.76 g/mol. Its IUPAC name is 2-[[4-[4-[2-[4-[4-[(2-carboxy-5-hydroxybenzoyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]anilino]oxymethyl]-4-hydroxybenzoic acid.
| Compound Name | 2-[[4-[4-[2-[4-[4-[(2-carboxy-5-hydroxybenzoyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]anilino]oxymethyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 20733227 |
| Molecular Formula | C43H36N2O10 |
| Molecular Weight | 740.76 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | 2-[[4-[4-[2-[4-[4-[(2-carboxy-5-hydroxybenzoyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]anilino]oxymethyl]-4-hydroxybenzoic acid |
| SMILES | CC(C)(c1ccc(Oc2ccc(NOCc3cc(O)ccc3C(=O)O)cc2)cc1)c1ccc(Oc2ccc(NC(=O)c3cc(O)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C43H36N2O10/c1-43(2,27-3-13-33(14-4-27)54-35-17-7-29(8-18-35)44-40(48)39-24-32(47)12-22-38(39)42(51)52)28-5-15-34(16-6-28)55-36-19-9-30(10-20-36)45-53-25-26-23-31(46)11-21-37(26)41(49)50/h3-24,45-47H,25H2,1-2H3,(H,44,48)(H,49,50)(H,51,52) |
| InChIKey | MAERLHQQTDBALO-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.76 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|