C33H32N2O10 — CID 59936076
2-[[4-[[4-[[2-(hydroperoxymethyl)-5-methoxycarbonylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-(methylperoxymethyl)benzoic acid (PubChem CID 59936076) has the molecular formula C33H32N2O10 and a molecular weight of 616.62 g/mol. Its IUPAC name is 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-methoxycarbonylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-(methylperoxymethyl)benzoic acid.
| Compound Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-methoxycarbonylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-(methylperoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 59936076 |
| Molecular Formula | C33H32N2O10 |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 2-[[4-[[4-[[2-(hydroperoxymethyl)-5-methoxycarbonylphenyl]methoxyamino]phenyl]methyl]phenyl]carbamoyl]-4-(methylperoxymethyl)benzoic acid |
| SMILES | COOCc1ccc(C(=O)O)c(C(=O)Nc2ccc(Cc3ccc(NOCc4cc(C(=O)OC)ccc4COO)cc3)cc2)c1 |
| InChI | InChI=1S/C33H32N2O10/c1-41-33(39)24-8-9-25(20-44-40)26(17-24)19-43-35-28-12-5-22(6-13-28)15-21-3-10-27(11-4-21)34-31(36)30-16-23(18-45-42-2)7-14-29(30)32(37)38/h3-14,16-17,35,40H,15,18-20H2,1-2H3,(H,34,36)(H,37,38) |
| InChIKey | TYBHSOZAVIBYSB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|