C33H30N4O10 — CID 20733361
2-[[4-[[4-[(2-carboxy-6-nitrobenzoyl)amino]-3-ethylphenyl]methyl]-2-ethylanilino]oxymethyl]-3-nitrobenzoic acid (PubChem CID 20733361) has the molecular formula C33H30N4O10 and a molecular weight of 642.62 g/mol. Its IUPAC name is 2-[[4-[[4-[(2-carboxy-6-nitrobenzoyl)amino]-3-ethylphenyl]methyl]-2-ethylanilino]oxymethyl]-3-nitrobenzoic acid.
| Compound Name | 2-[[4-[[4-[(2-carboxy-6-nitrobenzoyl)amino]-3-ethylphenyl]methyl]-2-ethylanilino]oxymethyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 20733361 |
| Molecular Formula | C33H30N4O10 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | 2-[[4-[[4-[(2-carboxy-6-nitrobenzoyl)amino]-3-ethylphenyl]methyl]-2-ethylanilino]oxymethyl]-3-nitrobenzoic acid |
| SMILES | CCc1cc(Cc2ccc(NC(=O)c3c(C(=O)O)cccc3[N+](=O)[O-])c(CC)c2)ccc1NOCc1c(C(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H30N4O10/c1-3-21-16-19(11-13-26(21)34-31(38)30-24(33(41)42)8-6-10-29(30)37(45)46)15-20-12-14-27(22(4-2)17-20)35-47-18-25-23(32(39)40)7-5-9-28(25)36(43)44/h5-14,16-17,35H,3-4,15,18H2,1-2H3,(H,34,38)(H,39,40)(H,41,42) |
| InChIKey | BGBLSTJEHLTMRA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 211.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|