C15H8N2O8-2 — CID 54707581
4-[(2-carboxy-6-nitrobenzoyl)amino]-2-oxidobenzoate (PubChem CID 54707581) has the molecular formula C15H8N2O8-2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 4-[(2-carboxy-6-nitrobenzoyl)amino]-2-oxidobenzoate.
| Compound Name | 4-[(2-carboxy-6-nitrobenzoyl)amino]-2-oxidobenzoate |
|---|---|
| PubChem CID | 54707581 |
| Molecular Formula | C15H8N2O8-2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4-[(2-carboxy-6-nitrobenzoyl)amino]-2-oxidobenzoate |
| SMILES | O=C([O-])c1ccc(NC(=O)c2c(C(=O)O)cccc2[N+](=O)[O-])cc1[O-] |
| InChI | InChI=1S/C15H10N2O8/c18-11-6-7(4-5-8(11)14(20)21)16-13(19)12-9(15(22)23)2-1-3-10(12)17(24)25/h1-6,18H,(H,16,19)(H,20,21)(H,22,23)/p-2 |
| InChIKey | DHBCHJPJSITNEZ-UHFFFAOYSA-L |
| XLogP | -0.02 |
| TPSA | 172.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|