C28H22N4O12S — CID 59936134
2-[[3-[3-[[2-(hydroperoxymethyl)-6-nitrophenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]-3-nitrobenzoic acid (PubChem CID 59936134) has the molecular formula C28H22N4O12S and a molecular weight of 638.57 g/mol. Its IUPAC name is 2-[[3-[3-[[2-(hydroperoxymethyl)-6-nitrophenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]-3-nitrobenzoic acid.
| Compound Name | 2-[[3-[3-[[2-(hydroperoxymethyl)-6-nitrophenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 59936134 |
| Molecular Formula | C28H22N4O12S |
| Molecular Weight | 638.57 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | 2-[[3-[3-[[2-(hydroperoxymethyl)-6-nitrophenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)Nc1cccc(S(=O)Oc2cccc(NOCc3c(COO)cccc3[N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H22N4O12S/c33-27(26-22(28(34)35)10-4-12-25(26)32(38)39)29-18-6-3-9-21(14-18)45(41)44-20-8-2-7-19(13-20)30-42-16-23-17(15-43-40)5-1-11-24(23)31(36)37/h1-14,30,40H,15-16H2,(H,29,33)(H,34,35) |
| InChIKey | JYZSLOWQEOKKKF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 229.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|