C30H25NO12 — CID 59935700
2-[4-[[4-[[2-(hydroperoxymethyl)-6-methylphenyl]methylperoxy]phenoxy]methoxy]phenoxy]carbonyl-3-nitrobenzoic acid (PubChem CID 59935700) has the molecular formula C30H25NO12 and a molecular weight of 591.53 g/mol. Its IUPAC name is 2-[4-[[4-[[2-(hydroperoxymethyl)-6-methylphenyl]methylperoxy]phenoxy]methoxy]phenoxy]carbonyl-3-nitrobenzoic acid.
| Compound Name | 2-[4-[[4-[[2-(hydroperoxymethyl)-6-methylphenyl]methylperoxy]phenoxy]methoxy]phenoxy]carbonyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 59935700 |
| Molecular Formula | C30H25NO12 |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 2-[4-[[4-[[2-(hydroperoxymethyl)-6-methylphenyl]methylperoxy]phenoxy]methoxy]phenoxy]carbonyl-3-nitrobenzoic acid |
| SMILES | Cc1cccc(COO)c1COOc1ccc(OCOc2ccc(OC(=O)c3c(C(=O)O)cccc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H25NO12/c1-19-4-2-5-20(16-40-37)26(19)17-41-43-24-14-10-22(11-15-24)39-18-38-21-8-12-23(13-9-21)42-30(34)28-25(29(32)33)6-3-7-27(28)31(35)36/h2-15,37H,16-18H2,1H3,(H,32,33) |
| InChIKey | AVYOSLLYLGRXCV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 173.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|