C28H25N3O10S — CID 59936051
4-aminoperoxy-2-[[3-[3-[[2-(hydroperoxymethyl)phenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]benzoic acid (PubChem CID 59936051) has the molecular formula C28H25N3O10S and a molecular weight of 595.59 g/mol. Its IUPAC name is 4-aminoperoxy-2-[[3-[3-[[2-(hydroperoxymethyl)phenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]benzoic acid.
| Compound Name | 4-aminoperoxy-2-[[3-[3-[[2-(hydroperoxymethyl)phenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59936051 |
| Molecular Formula | C28H25N3O10S |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | 4-aminoperoxy-2-[[3-[3-[[2-(hydroperoxymethyl)phenyl]methoxyamino]phenoxy]sulfinylphenyl]carbamoyl]benzoic acid |
| SMILES | NOOc1ccc(C(=O)O)c(C(=O)Nc2cccc(S(=O)Oc3cccc(NOCc4ccccc4COO)c3)c2)c1 |
| InChI | InChI=1S/C28H25N3O10S/c29-41-39-22-11-12-25(28(33)34)26(15-22)27(32)30-20-7-4-10-24(14-20)42(36)40-23-9-3-8-21(13-23)31-37-16-18-5-1-2-6-19(18)17-38-35/h1-15,31,35H,16-17,29H2,(H,30,32)(H,33,34) |
| InChIKey | WEBHBYORPGIXGD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 187.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|