C46H34N4O13 — CID 159264666
5-[4-[[4-[[4-[4-[(4-aminophenyl)carbamoyl]-3-carboxyphenyl]-2-carboxybenzoyl]amino]phenyl]methoxycarbonyl]-3-carboxyphenyl]-2-(methylcarbamoyl)benzoic acid (PubChem CID 159264666) has the molecular formula C46H34N4O13 and a molecular weight of 850.79 g/mol. Its IUPAC name is 5-[4-[[4-[[4-[4-[(4-aminophenyl)carbamoyl]-3-carboxyphenyl]-2-carboxybenzoyl]amino]phenyl]methoxycarbonyl]-3-carboxyphenyl]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 5-[4-[[4-[[4-[4-[(4-aminophenyl)carbamoyl]-3-carboxyphenyl]-2-carboxybenzoyl]amino]phenyl]methoxycarbonyl]-3-carboxyphenyl]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 159264666 |
| Molecular Formula | C46H34N4O13 |
| Molecular Weight | 850.79 g/mol |
| Exact Mass | 850.21 |
| IUPAC Name | 5-[4-[[4-[[4-[4-[(4-aminophenyl)carbamoyl]-3-carboxyphenyl]-2-carboxybenzoyl]amino]phenyl]methoxycarbonyl]-3-carboxyphenyl]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1ccc(-c2ccc(C(=O)OCc3ccc(NC(=O)c4ccc(-c5ccc(C(=O)Nc6ccc(N)cc6)c(C(=O)O)c5)cc4C(=O)O)cc3)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C46H34N4O13/c1-48-39(51)31-14-4-24(18-35(31)42(54)55)27-7-17-34(38(21-27)45(60)61)46(62)63-22-23-2-10-29(11-3-23)49-40(52)32-15-5-25(19-36(32)43(56)57)26-6-16-33(37(20-26)44(58)59)41(53)50-30-12-8-28(47)9-13-30/h2-21H,22,47H2,1H3,(H,48,51)(H,49,52)(H,50,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61) |
| InChIKey | SWYUNXLVPQWAOE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 288.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|