C34H34N4O6 — CID 19382559
propan-2-yl 2-[(4-aminophenyl)carbamoyl]-5-[3-[(4-aminophenyl)carbamoyl]-4-propan-2-yloxycarbonylphenyl]benzoate (PubChem CID 19382559) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is propan-2-yl 2-[(4-aminophenyl)carbamoyl]-5-[3-[(4-aminophenyl)carbamoyl]-4-propan-2-yloxycarbonylphenyl]benzoate.
| Compound Name | propan-2-yl 2-[(4-aminophenyl)carbamoyl]-5-[3-[(4-aminophenyl)carbamoyl]-4-propan-2-yloxycarbonylphenyl]benzoate |
|---|---|
| PubChem CID | 19382559 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | propan-2-yl 2-[(4-aminophenyl)carbamoyl]-5-[3-[(4-aminophenyl)carbamoyl]-4-propan-2-yloxycarbonylphenyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(-c2ccc(C(=O)Nc3ccc(N)cc3)c(C(=O)OC(C)C)c2)cc1C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C34H34N4O6/c1-19(2)43-33(41)28-16-6-21(17-29(28)32(40)38-26-13-9-24(36)10-14-26)22-5-15-27(30(18-22)34(42)44-20(3)4)31(39)37-25-11-7-23(35)8-12-25/h5-20H,35-36H2,1-4H3,(H,37,39)(H,38,40) |
| InChIKey | ZZZLCSSNAIQDHE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|