C24H25N3O4 — CID 68528508
bis[1-(4-aminophenyl)ethyl] 4-aminobenzene-1,2-dicarboxylate (PubChem CID 68528508) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is bis[1-(4-aminophenyl)ethyl] 4-aminobenzene-1,2-dicarboxylate.
| Compound Name | bis[1-(4-aminophenyl)ethyl] 4-aminobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 68528508 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | bis[1-(4-aminophenyl)ethyl] 4-aminobenzene-1,2-dicarboxylate |
| SMILES | CC(OC(=O)c1ccc(N)cc1C(=O)OC(C)c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-14(16-3-7-18(25)8-4-16)30-23(28)21-12-11-20(27)13-22(21)24(29)31-15(2)17-5-9-19(26)10-6-17/h3-15H,25-27H2,1-2H3 |
| InChIKey | GDTPWBKFFCCZEW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|