C42H40N2O11 — CID 134192398
2-(2-methylprop-2-enoyloxy)ethyl 2-acetyl-4-[3-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]benzoate (PubChem CID 134192398) has the molecular formula C42H40N2O11 and a molecular weight of 748.78 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-acetyl-4-[3-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]benzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-acetyl-4-[3-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]benzoate |
|---|---|
| PubChem CID | 134192398 |
| Molecular Formula | C42H40N2O11 |
| Molecular Weight | 748.78 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-acetyl-4-[3-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(-c2ccc(C(=O)OCCOC(=O)C(=C)C)c(C(=O)Nc3ccc(Oc4ccc(NC)cc4)cc3)c2)cc1C(C)=O |
| InChI | InChI=1S/C42H40N2O11/c1-25(2)39(47)51-19-21-53-41(49)34-17-7-28(23-36(34)27(5)45)29-8-18-35(42(50)54-22-20-52-40(48)26(3)4)37(24-29)38(46)44-31-11-15-33(16-12-31)55-32-13-9-30(43-6)10-14-32/h7-18,23-24,43H,1,3,19-22H2,2,4-6H3,(H,44,46) |
| InChIKey | ZJEJFTWXIBENQJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.78 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|