C35H31N3O8Si2 — CID 137331119
2-[[4-[4-(disilanylamino)phenoxy]phenyl]carbamoyl]-5-[[4-(4-methylphenoxy)phenyl]carbamoyl]terephthalic acid (PubChem CID 137331119) has the molecular formula C35H31N3O8Si2 and a molecular weight of 677.82 g/mol. Its IUPAC name is 2-[[4-[4-(disilanylamino)phenoxy]phenyl]carbamoyl]-5-[[4-(4-methylphenoxy)phenyl]carbamoyl]terephthalic acid.
| Compound Name | 2-[[4-[4-(disilanylamino)phenoxy]phenyl]carbamoyl]-5-[[4-(4-methylphenoxy)phenyl]carbamoyl]terephthalic acid |
|---|---|
| PubChem CID | 137331119 |
| Molecular Formula | C35H31N3O8Si2 |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 677.16 |
| IUPAC Name | 2-[[4-[4-(disilanylamino)phenoxy]phenyl]carbamoyl]-5-[[4-(4-methylphenoxy)phenyl]carbamoyl]terephthalic acid |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3cc(C(=O)O)c(C(=O)Nc4ccc(Oc5ccc(N[SiH2][SiH3])cc5)cc4)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C35H31N3O8Si2/c1-20-2-10-24(11-3-20)45-25-12-4-21(5-13-25)36-32(39)28-18-31(35(43)44)29(19-30(28)34(41)42)33(40)37-22-6-14-26(15-7-22)46-27-16-8-23(9-17-27)38-48-47/h2-19,38H,48H2,1,47H3,(H,36,39)(H,37,40)(H,41,42)(H,43,44) |
| InChIKey | XASUCYNVDMRSRJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|