C12H13N2O6- — CID 140957889
[2,5-dicarboxy-4-(methylcarbamoyl)phenyl]-(methylamino)methanolate (PubChem CID 140957889) has the molecular formula C12H13N2O6- and a molecular weight of 281.24 g/mol. Its IUPAC name is [2,5-dicarboxy-4-(methylcarbamoyl)phenyl]-(methylamino)methanolate.
| Compound Name | [2,5-dicarboxy-4-(methylcarbamoyl)phenyl]-(methylamino)methanolate |
|---|---|
| PubChem CID | 140957889 |
| Molecular Formula | C12H13N2O6- |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [2,5-dicarboxy-4-(methylcarbamoyl)phenyl]-(methylamino)methanolate |
| SMILES | CNC(=O)c1cc(C(=O)O)c(C([O-])NC)cc1C(=O)O |
| InChI | InChI=1S/C12H13N2O6/c1-13-9(15)5-3-8(12(19)20)6(10(16)14-2)4-7(5)11(17)18/h3-4,9,13H,1-2H3,(H,14,16)(H,17,18)(H,19,20)/q-1 |
| InChIKey | FCJVAHBERHVWSZ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|