C9H7ClI2O — CID 131191419
2-chloro-1-(2,4-diiodophenyl)propan-1-one (PubChem CID 131191419) has the molecular formula C9H7ClI2O and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-chloro-1-(2,4-diiodophenyl)propan-1-one.
| Compound Name | 2-chloro-1-(2,4-diiodophenyl)propan-1-one |
|---|---|
| PubChem CID | 131191419 |
| Molecular Formula | C9H7ClI2O |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 419.83 |
| IUPAC Name | 2-chloro-1-(2,4-diiodophenyl)propan-1-one |
| SMILES | CC(Cl)C(=O)c1ccc(I)cc1I |
| InChI | InChI=1S/C9H7ClI2O/c1-5(10)9(13)7-3-2-6(11)4-8(7)12/h2-5H,1H3 |
| InChIKey | FWPSHOFQSFHKIW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|