C13H14I3NO3 — CID 65220471
3-methyl-2-[[(2,3,5-triiodobenzoyl)amino]methyl]butanoic acid (PubChem CID 65220471) has the molecular formula C13H14I3NO3 and a molecular weight of 612.97 g/mol. Its IUPAC name is 3-methyl-2-[[(2,3,5-triiodobenzoyl)amino]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(2,3,5-triiodobenzoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65220471 |
| Molecular Formula | C13H14I3NO3 |
| Molecular Weight | 612.97 g/mol |
| Exact Mass | 612.81 |
| IUPAC Name | 3-methyl-2-[[(2,3,5-triiodobenzoyl)amino]methyl]butanoic acid |
| SMILES | CC(C)C(CNC(=O)c1cc(I)cc(I)c1I)C(=O)O |
| InChI | InChI=1S/C13H14I3NO3/c1-6(2)9(13(19)20)5-17-12(18)8-3-7(14)4-10(15)11(8)16/h3-4,6,9H,5H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | XMCBOYNQLLXODW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|