C14H16I3NO4 — CID 146366055
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,3,5-triiodobenzoate (PubChem CID 146366055) has the molecular formula C14H16I3NO4 and a molecular weight of 643.00 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,3,5-triiodobenzoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 146366055 |
| Molecular Formula | C14H16I3NO4 |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.82 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,3,5-triiodobenzoate |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H16I3NO4/c1-14(2,3)22-13(20)18-4-5-21-12(19)9-6-8(15)7-10(16)11(9)17/h6-7H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | XRLOINYVTDSAAX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|