C13H17INO4- — CID 138977057
(Z)-(2-iodocyclopenta-2,4-dien-1-ylidene)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]methanolate (PubChem CID 138977057) has the molecular formula C13H17INO4- and a molecular weight of 378.19 g/mol. Its IUPAC name is (Z)-(2-iodocyclopenta-2,4-dien-1-ylidene)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]methanolate.
| Compound Name | (Z)-(2-iodocyclopenta-2,4-dien-1-ylidene)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]methanolate |
|---|---|
| PubChem CID | 138977057 |
| Molecular Formula | C13H17INO4- |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (Z)-(2-iodocyclopenta-2,4-dien-1-ylidene)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]methanolate |
| SMILES | CC(C)(C)OC(=O)NCCO/C([O-])=C1/C=CC=C1I |
| InChI | InChI=1S/C13H18INO4/c1-13(2,3)19-12(17)15-7-8-18-11(16)9-5-4-6-10(9)14/h4-6,16H,7-8H2,1-3H3,(H,15,17)/p-1/b11-9- |
| InChIKey | PMLBXAIVMHBEHQ-LUAWRHEFSA-M |
| XLogP | 1.99 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|