C9H17N3O3 — CID 166923677
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-iminoethanimidate (PubChem CID 166923677) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-iminoethanimidate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-iminoethanimidate |
|---|---|
| PubChem CID | 166923677 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2-iminoethanimidate |
| SMILES | [H]/N=C/C(=N\[H])OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17N3O3/c1-9(2,3)15-8(13)12-4-5-14-7(11)6-10/h6,10-11H,4-5H2,1-3H3,(H,12,13)/b10-6+,11-7+ |
| InChIKey | WWJJXDDCVNZGFV-JMQWPVDRSA-N |
| XLogP | 1.15 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|