C13H23NO7 — CID 89398553
[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1-oxopropan-2-yl] 2-hydroxypropanoate (PubChem CID 89398553) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is [1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1-oxopropan-2-yl] 2-hydroxypropanoate.
| Compound Name | [1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1-oxopropan-2-yl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 89398553 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | [1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1-oxopropan-2-yl] 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OC(C)C(=O)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO7/c1-8(15)10(16)20-9(2)11(17)19-7-6-14-12(18)21-13(3,4)5/h8-9,15H,6-7H2,1-5H3,(H,14,18) |
| InChIKey | DBHWLNVSRQRYMN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|