C12H22N2O4S — CID 121002948
O-(2-acetamidoethyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate (PubChem CID 121002948) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is O-(2-acetamidoethyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate.
| Compound Name | O-(2-acetamidoethyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
|---|---|
| PubChem CID | 121002948 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | O-(2-acetamidoethyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
| SMILES | CC(=O)NCCOC(=S)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O4S/c1-9(15)13-7-8-17-10(19)5-6-14-11(16)18-12(2,3)4/h5-8H2,1-4H3,(H,13,15)(H,14,16) |
| InChIKey | RUGZRXJCSQDUOE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|