C8H13BO4 — CID 123197346
CID 123197346 (PubChem CID 123197346) has the molecular formula C8H13BO4 and a molecular weight of 184.00 g/mol.
| Compound Name | CID 123197346 |
|---|---|
| PubChem CID | 123197346 |
| Molecular Formula | C8H13BO4 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | — |
| SMILES | [B]C(CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C8H13BO4/c1-8(2,3)13-6(10)4-5(9)7(11)12/h5H,4H2,1-3H3,(H,11,12) |
| InChIKey | ULPWCHOZGKBZSX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|