C17H27N5O7 — CID 71664757
tert-butyl (3S)-3-azido-4-[[(2S,3R)-3-hydroxy-1-oxo-1-[(2-oxo-2-prop-2-enoxyethyl)amino]butan-2-yl]amino]-4-oxobutanoate (PubChem CID 71664757) has the molecular formula C17H27N5O7 and a molecular weight of 413.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-azido-4-[[(2S,3R)-3-hydroxy-1-oxo-1-[(2-oxo-2-prop-2-enoxyethyl)amino]butan-2-yl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-azido-4-[[(2S,3R)-3-hydroxy-1-oxo-1-[(2-oxo-2-prop-2-enoxyethyl)amino]butan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71664757 |
| Molecular Formula | C17H27N5O7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | tert-butyl (3S)-3-azido-4-[[(2S,3R)-3-hydroxy-1-oxo-1-[(2-oxo-2-prop-2-enoxyethyl)amino]butan-2-yl]amino]-4-oxobutanoate |
| SMILES | C=CCOC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(=O)OC(C)(C)C)N=[N+]=[N-])[C@@H](C)O |
| InChI | InChI=1S/C17H27N5O7/c1-6-7-28-13(25)9-19-16(27)14(10(2)23)20-15(26)11(21-22-18)8-12(24)29-17(3,4)5/h6,10-11,14,23H,1,7-9H2,2-5H3,(H,19,27)(H,20,26)/t10-,11+,14+/m1/s1 |
| InChIKey | XYUKYPQKZSNGSH-SUNKGSAMSA-N |
| XLogP | 0.11 |
| TPSA | 179.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|