C16H30N6O8 — CID 10478034
tert-butyl N-[(2S)-1-[[(2S,3R)-1-[[2-[(2-hydrazinyl-2-oxoethyl)amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 10478034) has the molecular formula C16H30N6O8 and a molecular weight of 434.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S,3R)-1-[[2-[(2-hydrazinyl-2-oxoethyl)amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S,3R)-1-[[2-[(2-hydrazinyl-2-oxoethyl)amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10478034 |
| Molecular Formula | C16H30N6O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S,3R)-1-[[2-[(2-hydrazinyl-2-oxoethyl)amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CO)NC(=O)OC(C)(C)C)C(=O)NCC(=O)NCC(=O)NN |
| InChI | InChI=1S/C16H30N6O8/c1-8(24)12(14(28)19-5-10(25)18-6-11(26)22-17)21-13(27)9(7-23)20-15(29)30-16(2,3)4/h8-9,12,23-24H,5-7,17H2,1-4H3,(H,18,25)(H,19,28)(H,20,29)(H,21,27)(H,22,26)/t8-,9+,12+/m1/s1 |
| InChIKey | BDNDUOGUGMSVMT-PTRXPTGYSA-N |
| XLogP | -4.04 |
| TPSA | 221.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|