C12H17N3O3 — CID 134389500
(3S,4R)-2-azido-5-(4-methylphenyl)pentane-1,3,4-triol (PubChem CID 134389500) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (3S,4R)-2-azido-5-(4-methylphenyl)pentane-1,3,4-triol.
| Compound Name | (3S,4R)-2-azido-5-(4-methylphenyl)pentane-1,3,4-triol |
|---|---|
| PubChem CID | 134389500 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (3S,4R)-2-azido-5-(4-methylphenyl)pentane-1,3,4-triol |
| SMILES | Cc1ccc(C[C@@H](O)[C@@H](O)C(CO)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H17N3O3/c1-8-2-4-9(5-3-8)6-11(17)12(18)10(7-16)14-15-13/h2-5,10-12,16-18H,6-7H2,1H3/t10?,11-,12+/m1/s1 |
| InChIKey | XKQCCNYNCAXDHW-SAIIYOCFSA-N |
| XLogP | 0.93 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|