C6H13NO2S — CID 88961577
(2R,3S)-1-methylsulfanyl-3-nitrosopentan-2-ol (PubChem CID 88961577) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is (2R,3S)-1-methylsulfanyl-3-nitrosopentan-2-ol.
| Compound Name | (2R,3S)-1-methylsulfanyl-3-nitrosopentan-2-ol |
|---|---|
| PubChem CID | 88961577 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (2R,3S)-1-methylsulfanyl-3-nitrosopentan-2-ol |
| SMILES | CC[C@H](N=O)[C@@H](O)CSC |
| InChI | InChI=1S/C6H13NO2S/c1-3-5(7-9)6(8)4-10-2/h5-6,8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | UCUVWODWSVVJJT-WDSKDSINSA-N |
| XLogP | 1.26 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |