C4H9NO4 — CID 89185145
3-nitrosobutane-1,2,4-triol (PubChem CID 89185145) has the molecular formula C4H9NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is 3-nitrosobutane-1,2,4-triol.
| Compound Name | 3-nitrosobutane-1,2,4-triol |
|---|---|
| PubChem CID | 89185145 |
| Molecular Formula | C4H9NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 3-nitrosobutane-1,2,4-triol |
| SMILES | O=NC(CO)C(O)CO |
| InChI | InChI=1S/C4H9NO4/c6-1-3(5-9)4(8)2-7/h3-4,6-8H,1-2H2 |
| InChIKey | KEHOFKUYLWEZEI-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |