C4H9NO3 — CID 163873378
3-nitrosobutane-1,2-diol (PubChem CID 163873378) has the molecular formula C4H9NO3 and a molecular weight of 119.12 g/mol. Its IUPAC name is 3-nitrosobutane-1,2-diol.
| Compound Name | 3-nitrosobutane-1,2-diol |
|---|---|
| PubChem CID | 163873378 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 3-nitrosobutane-1,2-diol |
| SMILES | CC(N=O)C(O)CO |
| InChI | InChI=1S/C4H9NO3/c1-3(5-8)4(7)2-6/h3-4,6-7H,2H2,1H3 |
| InChIKey | PMTQFRZLKHDIKY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |