C7H15NO5 — CID 163769371
(2R,3S,4R,5S)-5-nitrosoheptane-1,2,3,4-tetrol (PubChem CID 163769371) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-nitrosoheptane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R,5S)-5-nitrosoheptane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 163769371 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (2R,3S,4R,5S)-5-nitrosoheptane-1,2,3,4-tetrol |
| SMILES | CC[C@H](N=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5/c1-2-4(8-13)6(11)7(12)5(10)3-9/h4-7,9-12H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChIKey | MFCDQVQKOAXEHV-BDVNFPICSA-N |
| XLogP | -1.39 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |