C7H18N4O13 — CID 173297146
tris(nitric acid);4-nitrosoheptane-1,2,3-triol (PubChem CID 173297146) has the molecular formula C7H18N4O13 and a molecular weight of 366.24 g/mol. Its IUPAC name is tris(nitric acid);4-nitrosoheptane-1,2,3-triol.
| Compound Name | tris(nitric acid);4-nitrosoheptane-1,2,3-triol |
|---|---|
| PubChem CID | 173297146 |
| Molecular Formula | C7H18N4O13 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | tris(nitric acid);4-nitrosoheptane-1,2,3-triol |
| SMILES | CCCC(N=O)C(O)C(O)CO.O=[N+]([O-])O.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C7H15NO4.3HNO3/c1-2-3-5(8-12)7(11)6(10)4-9;3*2-1(3)4/h5-7,9-11H,2-4H2,1H3;3*(H,2,3,4) |
| InChIKey | KGWIVNWGXPXHJI-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 280.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|