C8H16N2O6 — CID 122468077
2,6-dinitrosooctane-1,3,4,5-tetrol (PubChem CID 122468077) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2,6-dinitrosooctane-1,3,4,5-tetrol.
| Compound Name | 2,6-dinitrosooctane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 122468077 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,6-dinitrosooctane-1,3,4,5-tetrol |
| SMILES | CCC(N=O)C(O)C(O)C(O)C(CO)N=O |
| InChI | InChI=1S/C8H16N2O6/c1-2-4(9-15)6(12)8(14)7(13)5(3-11)10-16/h4-8,11-14H,2-3H2,1H3 |
| InChIKey | KXKZJQOTNCTOJI-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |