About 2-nitrosopentan-3-ol
2-nitrosopentan-3-ol (PubChem CID 88945091) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-nitrosopentan-3-ol.
Molecular Properties
| Compound Name | 2-nitrosopentan-3-ol |
| PubChem CID | 88945091 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 2-nitrosopentan-3-ol |
| SMILES | CCC(O)C(C)N=O |
| InChI | InChI=1S/C5H11NO2/c1-3-5(7)4(2)6-8/h4-5,7H,3H2,1-2H3 |
| InChIKey | ZFJHUMIDIFATOW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-nitrosopentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosopentan-3-ol?
The IUPAC name of 2-nitrosopentan-3-ol (CID 88945091) is 2-nitrosopentan-3-ol.
What is the SMILES notation for 2-nitrosopentan-3-ol?
The canonical SMILES for 2-nitrosopentan-3-ol is CCC(O)C(C)N=O.
What is the InChIKey of 2-nitrosopentan-3-ol?
The InChIKey is ZFJHUMIDIFATOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-3-5(7)4(2)6-8/h4-5,7H,3H2,1-2H3.
What are the key properties of 2-nitrosopentan-3-ol?
2-nitrosopentan-3-ol has a molecular weight of 117.15 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosopentan-3-ol is sourced from PubChem (CID 88945091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).