About (3S)-3-nitrosobutan-2-ol
(3S)-3-nitrosobutan-2-ol (PubChem CID 163745511) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is (3S)-3-nitrosobutan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-nitrosobutan-2-ol |
| PubChem CID | 163745511 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | (3S)-3-nitrosobutan-2-ol |
| SMILES | CC(O)[C@H](C)N=O |
| InChI | InChI=1S/C4H9NO2/c1-3(5-7)4(2)6/h3-4,6H,1-2H3/t3-,4?/m0/s1 |
| InChIKey | LLNBYWVYUUHGCG-WUCPZUCCSA-N |
| XLogP | 0.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-nitrosobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-nitrosobutan-2-ol?
The IUPAC name of (3S)-3-nitrosobutan-2-ol (CID 163745511) is (3S)-3-nitrosobutan-2-ol.
What is the SMILES notation for (3S)-3-nitrosobutan-2-ol?
The canonical SMILES for (3S)-3-nitrosobutan-2-ol is CC(O)[C@H](C)N=O.
What is the InChIKey of (3S)-3-nitrosobutan-2-ol?
The InChIKey is LLNBYWVYUUHGCG-WUCPZUCCSA-N. The full InChI is InChI=1S/C4H9NO2/c1-3(5-7)4(2)6/h3-4,6H,1-2H3/t3-,4?/m0/s1.
What are the key properties of (3S)-3-nitrosobutan-2-ol?
(3S)-3-nitrosobutan-2-ol has a molecular weight of 103.12 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-nitrosobutan-2-ol is sourced from PubChem (CID 163745511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).