About butane-2,3-diol;dioxoosmium
butane-2,3-diol;dioxoosmium (PubChem CID 58655346) has the molecular formula C4H10O4Os
and a molecular weight of 312.35 g/mol. Its IUPAC name is butane-2,3-diol;dioxoosmium.
Molecular Properties
| Compound Name | butane-2,3-diol;dioxoosmium |
| PubChem CID | 58655346 |
| Molecular Formula | C4H10O4Os |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | butane-2,3-diol;dioxoosmium |
| SMILES | CC(O)C(C)O.O=[Os]=O |
| InChI | InChI=1S/C4H10O2.2O.Os/c1-3(5)4(2)6;;;/h3-6H,1-2H3;;; |
| InChIKey | FIKQUJPYUNZHAR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butane-2,3-diol;dioxoosmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-diol;dioxoosmium?
The IUPAC name of butane-2,3-diol;dioxoosmium (CID 58655346) is butane-2,3-diol;dioxoosmium.
What is the SMILES notation for butane-2,3-diol;dioxoosmium?
The canonical SMILES for butane-2,3-diol;dioxoosmium is CC(O)C(C)O.O=[Os]=O.
What is the InChIKey of butane-2,3-diol;dioxoosmium?
The InChIKey is FIKQUJPYUNZHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.2O.Os/c1-3(5)4(2)6;;;/h3-6H,1-2H3;;;.
What are the key properties of butane-2,3-diol;dioxoosmium?
butane-2,3-diol;dioxoosmium has a molecular weight of 312.35 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-diol;dioxoosmium is sourced from PubChem (CID 58655346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).