About 1-nitrosoethanethiol
1-nitrosoethanethiol (PubChem CID 173133459) has the molecular formula C2H5NOS
and a molecular weight of 91.13 g/mol. Its IUPAC name is 1-nitrosoethanethiol.
Molecular Properties
| Compound Name | 1-nitrosoethanethiol |
| PubChem CID | 173133459 |
| Molecular Formula | C2H5NOS |
| Molecular Weight | 91.13 g/mol |
| Exact Mass | 91.01 |
| IUPAC Name | 1-nitrosoethanethiol |
| SMILES | CC(S)N=O |
| InChI | InChI=1S/C2H5NOS/c1-2(5)3-4/h2,5H,1H3 |
| InChIKey | JVYMOIGONALHMZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.13 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrosoethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrosoethanethiol?
The IUPAC name of 1-nitrosoethanethiol (CID 173133459) is 1-nitrosoethanethiol.
What is the SMILES notation for 1-nitrosoethanethiol?
The canonical SMILES for 1-nitrosoethanethiol is CC(S)N=O.
What is the InChIKey of 1-nitrosoethanethiol?
The InChIKey is JVYMOIGONALHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NOS/c1-2(5)3-4/h2,5H,1H3.
What are the key properties of 1-nitrosoethanethiol?
1-nitrosoethanethiol has a molecular weight of 91.13 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrosoethanethiol is sourced from PubChem (CID 173133459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).