About 1-diazenylethanethiol
1-diazenylethanethiol (PubChem CID 173486196) has the molecular formula C2H6N2S
and a molecular weight of 90.15 g/mol. Its IUPAC name is 1-diazenylethanethiol.
Molecular Properties
| Compound Name | 1-diazenylethanethiol |
| PubChem CID | 173486196 |
| Molecular Formula | C2H6N2S |
| Molecular Weight | 90.15 g/mol |
| Exact Mass | 90.03 |
| IUPAC Name | 1-diazenylethanethiol |
| SMILES | [H]/N=N/C(C)S |
| InChI | InChI=1S/C2H6N2S/c1-2(5)4-3/h2-3,5H,1H3/b4-3+ |
| InChIKey | IDJTUVWQMBHBJC-ONEGZZNKSA-N |
| XLogP | 1.29 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-diazenylethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazenylethanethiol?
The IUPAC name of 1-diazenylethanethiol (CID 173486196) is 1-diazenylethanethiol.
What is the SMILES notation for 1-diazenylethanethiol?
The canonical SMILES for 1-diazenylethanethiol is [H]/N=N/C(C)S.
What is the InChIKey of 1-diazenylethanethiol?
The InChIKey is IDJTUVWQMBHBJC-ONEGZZNKSA-N. The full InChI is InChI=1S/C2H6N2S/c1-2(5)4-3/h2-3,5H,1H3/b4-3+.
What are the key properties of 1-diazenylethanethiol?
1-diazenylethanethiol has a molecular weight of 90.15 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazenylethanethiol is sourced from PubChem (CID 173486196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).