About 2-diazenylpropanoic acid
2-diazenylpropanoic acid (PubChem CID 54345644) has the molecular formula C3H6N2O2
and a molecular weight of 102.09 g/mol. Its IUPAC name is 2-diazenylpropanoic acid.
Molecular Properties
| Compound Name | 2-diazenylpropanoic acid |
| PubChem CID | 54345644 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | 2-diazenylpropanoic acid |
| SMILES | [H]/N=N/C(C)C(=O)O |
| InChI | InChI=1S/C3H6N2O2/c1-2(5-4)3(6)7/h2,4H,1H3,(H,6,7)/b5-4+ |
| InChIKey | UCDDYAJLRSNZBZ-SNAWJCMRSA-N |
| XLogP | 0.49 |
| TPSA | 73.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenylpropanoic acid?
The IUPAC name of 2-diazenylpropanoic acid (CID 54345644) is 2-diazenylpropanoic acid.
What is the SMILES notation for 2-diazenylpropanoic acid?
The canonical SMILES for 2-diazenylpropanoic acid is [H]/N=N/C(C)C(=O)O.
What is the InChIKey of 2-diazenylpropanoic acid?
The InChIKey is UCDDYAJLRSNZBZ-SNAWJCMRSA-N. The full InChI is InChI=1S/C3H6N2O2/c1-2(5-4)3(6)7/h2,4H,1H3,(H,6,7)/b5-4+.
What are the key properties of 2-diazenylpropanoic acid?
2-diazenylpropanoic acid has a molecular weight of 102.09 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenylpropanoic acid is sourced from PubChem (CID 54345644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).