About nonan-5-yldiazene
nonan-5-yldiazene (PubChem CID 123930065) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is nonan-5-yldiazene.
Molecular Properties
| Compound Name | nonan-5-yldiazene |
| PubChem CID | 123930065 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | nonan-5-yldiazene |
| SMILES | [H]/N=N/C(CCCC)CCCC |
| InChI | InChI=1S/C9H20N2/c1-3-5-7-9(11-10)8-6-4-2/h9-10H,3-8H2,1-2H3/b11-10+ |
| InChIKey | UDLWIRBSWBWQBZ-ZHACJKMWSA-N |
| XLogP | 3.77 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze nonan-5-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-5-yldiazene?
The IUPAC name of nonan-5-yldiazene (CID 123930065) is nonan-5-yldiazene.
What is the SMILES notation for nonan-5-yldiazene?
The canonical SMILES for nonan-5-yldiazene is [H]/N=N/C(CCCC)CCCC.
What is the InChIKey of nonan-5-yldiazene?
The InChIKey is UDLWIRBSWBWQBZ-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H20N2/c1-3-5-7-9(11-10)8-6-4-2/h9-10H,3-8H2,1-2H3/b11-10+.
What are the key properties of nonan-5-yldiazene?
nonan-5-yldiazene has a molecular weight of 156.27 g/mol, XLogP of 3.77, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-5-yldiazene is sourced from PubChem (CID 123930065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).