About 2-nonan-5-ylguanidine
2-nonan-5-ylguanidine (PubChem CID 88763433) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-nonan-5-ylguanidine.
Molecular Properties
| Compound Name | 2-nonan-5-ylguanidine |
| PubChem CID | 88763433 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 2-nonan-5-ylguanidine |
| SMILES | CCCCC(CCCC)N=C(N)N |
| InChI | InChI=1S/C10H23N3/c1-3-5-7-9(8-6-4-2)13-10(11)12/h9H,3-8H2,1-2H3,(H4,11,12,13) |
| InChIKey | RAILVCNXFCMBAY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-nonan-5-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonan-5-ylguanidine?
The IUPAC name of 2-nonan-5-ylguanidine (CID 88763433) is 2-nonan-5-ylguanidine.
What is the SMILES notation for 2-nonan-5-ylguanidine?
The canonical SMILES for 2-nonan-5-ylguanidine is CCCCC(CCCC)N=C(N)N.
What is the InChIKey of 2-nonan-5-ylguanidine?
The InChIKey is RAILVCNXFCMBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3/c1-3-5-7-9(8-6-4-2)13-10(11)12/h9H,3-8H2,1-2H3,(H4,11,12,13).
What are the key properties of 2-nonan-5-ylguanidine?
2-nonan-5-ylguanidine has a molecular weight of 185.31 g/mol, XLogP of 2.01, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonan-5-ylguanidine is sourced from PubChem (CID 88763433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).