About 2-octan-4-ylguanidine
2-octan-4-ylguanidine (PubChem CID 106025621) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-octan-4-ylguanidine.
Molecular Properties
| Compound Name | 2-octan-4-ylguanidine |
| PubChem CID | 106025621 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-octan-4-ylguanidine |
| SMILES | CCCCC(CCC)N=C(N)N |
| InChI | InChI=1S/C9H21N3/c1-3-5-7-8(6-4-2)12-9(10)11/h8H,3-7H2,1-2H3,(H4,10,11,12) |
| InChIKey | ATCJQIAQKRGDGV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-octan-4-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octan-4-ylguanidine?
The IUPAC name of 2-octan-4-ylguanidine (CID 106025621) is 2-octan-4-ylguanidine.
What is the SMILES notation for 2-octan-4-ylguanidine?
The canonical SMILES for 2-octan-4-ylguanidine is CCCCC(CCC)N=C(N)N.
What is the InChIKey of 2-octan-4-ylguanidine?
The InChIKey is ATCJQIAQKRGDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-3-5-7-8(6-4-2)12-9(10)11/h8H,3-7H2,1-2H3,(H4,10,11,12).
What are the key properties of 2-octan-4-ylguanidine?
2-octan-4-ylguanidine has a molecular weight of 171.29 g/mol, XLogP of 1.62, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octan-4-ylguanidine is sourced from PubChem (CID 106025621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).