About 2-decan-5-ylguanidine
2-decan-5-ylguanidine (PubChem CID 146527866) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-decan-5-ylguanidine.
Molecular Properties
| Compound Name | 2-decan-5-ylguanidine |
| PubChem CID | 146527866 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 2-decan-5-ylguanidine |
| SMILES | CCCCCC(CCCC)N=C(N)N |
| InChI | InChI=1S/C11H25N3/c1-3-5-7-9-10(8-6-4-2)14-11(12)13/h10H,3-9H2,1-2H3,(H4,12,13,14) |
| InChIKey | OJJZEOKVLABMLX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-decan-5-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decan-5-ylguanidine?
The IUPAC name of 2-decan-5-ylguanidine (CID 146527866) is 2-decan-5-ylguanidine.
What is the SMILES notation for 2-decan-5-ylguanidine?
The canonical SMILES for 2-decan-5-ylguanidine is CCCCCC(CCCC)N=C(N)N.
What is the InChIKey of 2-decan-5-ylguanidine?
The InChIKey is OJJZEOKVLABMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3/c1-3-5-7-9-10(8-6-4-2)14-11(12)13/h10H,3-9H2,1-2H3,(H4,12,13,14).
What are the key properties of 2-decan-5-ylguanidine?
2-decan-5-ylguanidine has a molecular weight of 199.34 g/mol, XLogP of 2.40, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decan-5-ylguanidine is sourced from PubChem (CID 146527866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).