C16H36N6O3Si — CID 175003228
(1,7-didiazenyl-10-triethoxysilyldecan-4-yl)diazene (PubChem CID 175003228) has the molecular formula C16H36N6O3Si and a molecular weight of 388.59 g/mol. Its IUPAC name is (1,7-didiazenyl-10-triethoxysilyldecan-4-yl)diazene.
| Compound Name | (1,7-didiazenyl-10-triethoxysilyldecan-4-yl)diazene |
|---|---|
| PubChem CID | 175003228 |
| Molecular Formula | C16H36N6O3Si |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (1,7-didiazenyl-10-triethoxysilyldecan-4-yl)diazene |
| SMILES | [H]/N=N/CCCC(CCC(CCC[Si](OCC)(OCC)OCC)/N=N/[H])/N=N/[H] |
| InChI | InChI=1S/C16H36N6O3Si/c1-4-23-26(24-5-2,25-6-3)14-8-10-16(22-19)12-11-15(21-18)9-7-13-20-17/h15-19H,4-14H2,1-3H3/b20-17+,21-18+,22-19+ |
| InChIKey | PTEBOQOFZRQSCF-PNAPYWFZSA-N |
| XLogP | 5.21 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|