C19H42N2O6Si2 — CID 11339909
N,N'-bis(3-triethoxysilylpropyl)methanediimine (PubChem CID 11339909) has the molecular formula C19H42N2O6Si2 and a molecular weight of 450.73 g/mol. Its IUPAC name is N,N'-bis(3-triethoxysilylpropyl)methanediimine.
| Compound Name | N,N'-bis(3-triethoxysilylpropyl)methanediimine |
|---|---|
| PubChem CID | 11339909 |
| Molecular Formula | C19H42N2O6Si2 |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N,N'-bis(3-triethoxysilylpropyl)methanediimine |
| SMILES | CCO[Si](CCCN=C=NCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C19H42N2O6Si2/c1-7-22-28(23-8-2,24-9-3)17-13-15-20-19-21-16-14-18-29(25-10-4,26-11-5)27-12-6/h7-18H2,1-6H3 |
| InChIKey | BAESHILMXXYHGC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|